C22H16F5N5O3S — CID 157038127
6-(3-ethylsulfonyl-6-pyrimidin-2-yl-2-pyridinyl)-2-(2,2,3,3,3-pentafluoropropyl)-2,7-naphthyridin-1-one (PubChem CID 157038127) has the molecular formula C22H16F5N5O3S and a molecular weight of 525.46 g/mol. Its IUPAC name is 6-(3-ethylsulfonyl-6-pyrimidin-2-yl-2-pyridinyl)-2-(2,2,3,3,3-pentafluoropropyl)-2,7-naphthyridin-1-one.
| Compound Name | 6-(3-ethylsulfonyl-6-pyrimidin-2-yl-2-pyridinyl)-2-(2,2,3,3,3-pentafluoropropyl)-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 157038127 |
| Molecular Formula | C22H16F5N5O3S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 6-(3-ethylsulfonyl-6-pyrimidin-2-yl-2-pyridinyl)-2-(2,2,3,3,3-pentafluoropropyl)-2,7-naphthyridin-1-one |
| SMILES | CCS(=O)(=O)c1ccc(-c2ncccn2)nc1-c1cc2ccn(CC(F)(F)C(F)(F)F)c(=O)c2cn1 |
| InChI | InChI=1S/C22H16F5N5O3S/c1-2-36(34,35)17-5-4-15(19-28-7-3-8-29-19)31-18(17)16-10-13-6-9-32(20(33)14(13)11-30-16)12-21(23,24)22(25,26)27/h3-11H,2,12H2,1H3 |
| InChIKey | UCNDONAEZQZLNW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 107.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|