About 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol
4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol (PubChem CID 157038707) has the molecular formula C14H28N4O
and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol.
Molecular Properties
| Compound Name | 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol |
| PubChem CID | 157038707 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol |
| SMILES | CCC(C)(CO)CC(C)(CC)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C14H28N4O/c1-5-13(3,9-14(4,6-2)11-19)10-18-8-12(7-15)16-17-18/h8,19H,5-7,9-11,15H2,1-4H3 |
| InChIKey | SKRMQIXYMPRJHX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol?
The IUPAC name of 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol (CID 157038707) is 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol.
What is the SMILES notation for 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol?
The canonical SMILES for 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol is CCC(C)(CO)CC(C)(CC)Cn1cc(CN)nn1.
What is the InChIKey of 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol?
The InChIKey is SKRMQIXYMPRJHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O/c1-5-13(3,9-14(4,6-2)11-19)10-18-8-12(7-15)16-17-18/h8,19H,5-7,9-11,15H2,1-4H3.
What are the key properties of 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol?
4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol has a molecular weight of 268.40 g/mol, XLogP of 1.95, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(aminomethyl)triazol-1-yl]methyl]-2-ethyl-2,4-dimethylhexan-1-ol is sourced from PubChem (CID 157038707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).