C12H18N2O3 — CID 157038979
1-(2-pyridin-2-ylethyl)piperidine-3,4,5-triol (PubChem CID 157038979) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(2-pyridin-2-ylethyl)piperidine-3,4,5-triol.
| Compound Name | 1-(2-pyridin-2-ylethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157038979 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-(2-pyridin-2-ylethyl)piperidine-3,4,5-triol |
| SMILES | OC1CN(CCc2ccccn2)CC(O)C1O |
| InChI | InChI=1S/C12H18N2O3/c15-10-7-14(8-11(16)12(10)17)6-4-9-3-1-2-5-13-9/h1-3,5,10-12,15-17H,4,6-8H2 |
| InChIKey | DLOSJNFCWWEZNL-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |