About 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol
1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 157039390) has the molecular formula C15H27NO4
and a molecular weight of 285.38 g/mol. Its IUPAC name is 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
Molecular Properties
| Compound Name | 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| PubChem CID | 157039390 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | C=CC1CCC(CN2CC(O)C(O)C(O)C2CO)CC1 |
| InChI | InChI=1S/C15H27NO4/c1-2-10-3-5-11(6-4-10)7-16-8-13(18)15(20)14(19)12(16)9-17/h2,10-15,17-20H,1,3-9H2 |
| InChIKey | SWXLNPCUQIDMAR-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol?
The IUPAC name of 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (CID 157039390) is 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
What is the SMILES notation for 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol?
The canonical SMILES for 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol is C=CC1CCC(CN2CC(O)C(O)C(O)C2CO)CC1.
What is the InChIKey of 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol?
The InChIKey is SWXLNPCUQIDMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO4/c1-2-10-3-5-11(6-4-10)7-16-8-13(18)15(20)14(19)12(16)9-17/h2,10-15,17-20H,1,3-9H2.
What are the key properties of 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol?
1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol has a molecular weight of 285.38 g/mol, XLogP of -0.26, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-ethenylcyclohexyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol is sourced from PubChem (CID 157039390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).