C14H18ClF2NO4 — CID 157039582
(2S,3R,4R,5S)-1-[2-(3-chloro-2,6-difluorophenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 157039582) has the molecular formula C14H18ClF2NO4 and a molecular weight of 337.75 g/mol. Its IUPAC name is (2S,3R,4R,5S)-1-[2-(3-chloro-2,6-difluorophenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-1-[2-(3-chloro-2,6-difluorophenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039582 |
| Molecular Formula | C14H18ClF2NO4 |
| Molecular Weight | 337.75 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (2S,3R,4R,5S)-1-[2-(3-chloro-2,6-difluorophenyl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C14H18ClF2NO4/c15-8-1-2-9(16)7(12(8)17)3-4-18-5-11(20)14(22)13(21)10(18)6-19/h1-2,10-11,13-14,19-22H,3-6H2/t10-,11-,13+,14+/m0/s1 |
| InChIKey | KKPZHIXQKNJOFI-CDGCEXEKSA-N |
| XLogP | -0.08 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.75 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|