C42H43F2NO4 — CID 157039617
(2R,3R,4R,5S)-1-[2-(2,6-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine (PubChem CID 157039617) has the molecular formula C42H43F2NO4 and a molecular weight of 663.81 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-(2,6-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine.
| Compound Name | (2R,3R,4R,5S)-1-[2-(2,6-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 157039617 |
| Molecular Formula | C42H43F2NO4 |
| Molecular Weight | 663.81 g/mol |
| Exact Mass | 663.32 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-(2,6-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
| SMILES | Fc1cccc(F)c1CCN1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C42H43F2NO4/c43-37-22-13-23-38(44)36(37)24-25-45-26-40(47-28-33-16-7-2-8-17-33)42(49-30-35-20-11-4-12-21-35)41(48-29-34-18-9-3-10-19-34)39(45)31-46-27-32-14-5-1-6-15-32/h1-23,39-42H,24-31H2/t39-,40+,41-,42-/m1/s1 |
| InChIKey | KETVPNCKZHOSPL-SZRGUQLDSA-N |
| XLogP | 8.16 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.81 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |