C43H49F2NO5 — CID 157039707
[4-(1,1-difluoroethyl)cyclohexyl]-[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methanone (PubChem CID 157039707) has the molecular formula C43H49F2NO5 and a molecular weight of 697.86 g/mol. Its IUPAC name is [4-(1,1-difluoroethyl)cyclohexyl]-[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methanone.
| Compound Name | [4-(1,1-difluoroethyl)cyclohexyl]-[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 157039707 |
| Molecular Formula | C43H49F2NO5 |
| Molecular Weight | 697.86 g/mol |
| Exact Mass | 697.36 |
| IUPAC Name | [4-(1,1-difluoroethyl)cyclohexyl]-[(2S,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]methanone |
| SMILES | CC(F)(F)C1CCC(C(=O)N2C[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2COCc2ccccc2)CC1 |
| InChI | InChI=1S/C43H49F2NO5/c1-43(44,45)37-24-22-36(23-25-37)42(47)46-26-39(49-28-33-16-8-3-9-17-33)41(51-30-35-20-12-5-13-21-35)40(50-29-34-18-10-4-11-19-34)38(46)31-48-27-32-14-6-2-7-15-32/h2-21,36-41H,22-31H2,1H3/t36?,37?,38-,39-,40+,41+/m0/s1 |
| InChIKey | UGDFGCLGJSFSFF-IDBYKDHSSA-N |
| XLogP | 8.63 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.86 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |