C17H29F3N2O4 — CID 157039716
(2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[1-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]azetidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 157039716) has the molecular formula C17H29F3N2O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[1-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]azetidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[1-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]azetidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039716 |
| Molecular Formula | C17H29F3N2O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[[1-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]azetidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | OC[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CC1CN([C@H]2CCCC[C@H]2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H29F3N2O4/c18-17(19,20)11-3-1-2-4-12(11)21-5-10(6-21)7-22-8-14(24)16(26)15(25)13(22)9-23/h10-16,23-26H,1-9H2/t11-,12+,13+,14+,15-,16-/m1/s1 |
| InChIKey | FPDAVSZQLIKMEG-FOLNQXHWSA-N |
| XLogP | -0.20 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |