C16H23F3N4O4 — CID 157039792
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3S)-1-[4-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 157039792) has the molecular formula C16H23F3N4O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3S)-1-[4-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3S)-1-[4-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039792 |
| Molecular Formula | C16H23F3N4O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[(3S)-1-[4-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1C[C@@H]1CCN(c2cncnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H23F3N4O4/c17-16(18,19)15-10(3-20-8-21-15)22-2-1-9(4-22)5-23-6-12(25)14(27)13(26)11(23)7-24/h3,8-9,11-14,24-27H,1-2,4-7H2/t9-,11-,12+,13-,14-/m1/s1 |
| InChIKey | NQHYAXAZHPGVJN-RGCYKPLRSA-N |
| XLogP | -0.92 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |