C37H42N2O6Si — CID 157040375
CID 157040375 (PubChem CID 157040375) has the molecular formula C37H42N2O6Si and a molecular weight of 638.84 g/mol.
| Compound Name | CID 157040375 |
|---|---|
| PubChem CID | 157040375 |
| Molecular Formula | C37H42N2O6Si |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | — |
| SMILES | CNCCc1cc(OC)c(OC)c2c1[Si]Cc1ccc(OC)c(c1)Oc1ccc(cc1)C[C@H]1c3cc(c(OC)cc3CCN1C)O2 |
| InChI | InChI=1S/C37H42N2O6Si/c1-38-15-13-26-20-34(42-5)35(43-6)36-37(26)46-22-24-9-12-30(40-3)32(18-24)44-27-10-7-23(8-11-27)17-29-28-21-33(45-36)31(41-4)19-25(28)14-16-39(29)2/h7-12,18-21,29,38H,13-17,22H2,1-6H3/t29-/m0/s1 |
| InChIKey | VKHZLTFYRUKPCU-LJAQVGFWSA-N |
| XLogP | 5.68 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|