C16H30N4O6 — CID 157040384
2,6-diamino-2,6-bis(4-aminobutyl)-4-methyl-3,5-dioxoheptanedioic acid (PubChem CID 157040384) has the molecular formula C16H30N4O6 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2,6-diamino-2,6-bis(4-aminobutyl)-4-methyl-3,5-dioxoheptanedioic acid.
| Compound Name | 2,6-diamino-2,6-bis(4-aminobutyl)-4-methyl-3,5-dioxoheptanedioic acid |
|---|---|
| PubChem CID | 157040384 |
| Molecular Formula | C16H30N4O6 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2,6-diamino-2,6-bis(4-aminobutyl)-4-methyl-3,5-dioxoheptanedioic acid |
| SMILES | CC(C(=O)C(N)(CCCCN)C(=O)O)C(=O)C(N)(CCCCN)C(=O)O |
| InChI | InChI=1S/C16H30N4O6/c1-10(11(21)15(19,13(23)24)6-2-4-8-17)12(22)16(20,14(25)26)7-3-5-9-18/h10H,2-9,17-20H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | ZZCVIDIGOUTQIJ-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 212.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|