About 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile
4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile (PubChem CID 157040458) has the molecular formula C13H7F5N4O
and a molecular weight of 330.22 g/mol. Its IUPAC name is 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile |
| PubChem CID | 157040458 |
| Molecular Formula | C13H7F5N4O |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile |
| SMILES | Cc1c(Oc2c(F)cc(C#N)cc2F)nc(N)nc1C(F)(F)F |
| InChI | InChI=1S/C13H7F5N4O/c1-5-10(13(16,17)18)21-12(20)22-11(5)23-9-7(14)2-6(4-19)3-8(9)15/h2-3H,1H3,(H2,20,21,22) |
| InChIKey | UPJAVBCZLMPSFW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile?
The IUPAC name of 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile (CID 157040458) is 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile?
The canonical SMILES for 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile is Cc1c(Oc2c(F)cc(C#N)cc2F)nc(N)nc1C(F)(F)F.
What is the InChIKey of 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile?
The InChIKey is UPJAVBCZLMPSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F5N4O/c1-5-10(13(16,17)18)21-12(20)22-11(5)23-9-7(14)2-6(4-19)3-8(9)15/h2-3H,1H3,(H2,20,21,22).
What are the key properties of 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile?
4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile has a molecular weight of 330.22 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-amino-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxy-3,5-difluorobenzonitrile is sourced from PubChem (CID 157040458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).