C15H35N — CID 157040656
ethane;N,2,4-trimethyl-N-(3-methylbutyl)pentan-2-amine (PubChem CID 157040656) has the molecular formula C15H35N and a molecular weight of 229.45 g/mol. Its IUPAC name is ethane;N,2,4-trimethyl-N-(3-methylbutyl)pentan-2-amine.
| Compound Name | ethane;N,2,4-trimethyl-N-(3-methylbutyl)pentan-2-amine |
|---|---|
| PubChem CID | 157040656 |
| Molecular Formula | C15H35N |
| Molecular Weight | 229.45 g/mol |
| Exact Mass | 229.28 |
| IUPAC Name | ethane;N,2,4-trimethyl-N-(3-methylbutyl)pentan-2-amine |
| SMILES | CC.CC(C)CCN(C)C(C)(C)CC(C)C |
| InChI | InChI=1S/C13H29N.C2H6/c1-11(2)8-9-14(7)13(5,6)10-12(3)4;1-2/h11-12H,8-10H2,1-7H3;1-2H3 |
| InChIKey | TXDMIVMQKDQHJK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |