About cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one
cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one (PubChem CID 157041036) has the molecular formula C17H25NO2S
and a molecular weight of 307.46 g/mol. Its IUPAC name is cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one.
Molecular Properties
| Compound Name | cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one |
| PubChem CID | 157041036 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one |
| SMILES | C1CCCCC1.COc1ccc2c(=O)cc[nH]c2c1.CS |
| InChI | InChI=1S/C10H9NO2.C6H12.CH4S/c1-13-7-2-3-8-9(6-7)11-5-4-10(8)12;1-2-4-6-5-3-1;1-2/h2-6H,1H3,(H,11,12);1-6H2;2H,1H3 |
| InChIKey | FWFRVIBFGMAUAE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one?
The IUPAC name of cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one (CID 157041036) is cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one.
What is the SMILES notation for cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one?
The canonical SMILES for cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one is C1CCCCC1.COc1ccc2c(=O)cc[nH]c2c1.CS.
What is the InChIKey of cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one?
The InChIKey is FWFRVIBFGMAUAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.C6H12.CH4S/c1-13-7-2-3-8-9(6-7)11-5-4-10(8)12;1-2-4-6-5-3-1;1-2/h2-6H,1H3,(H,11,12);1-6H2;2H,1H3.
What are the key properties of cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one?
cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one has a molecular weight of 307.46 g/mol, XLogP of 4.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;methanethiol;7-methoxy-1H-quinolin-4-one is sourced from PubChem (CID 157041036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).