C20H24N5O5P — CID 157041437
2-[2-[[6-hydroxy-7-methoxy-2-[(E)-2-pyridin-3-ylethenyl]quinazolin-4-yl]amino]ethylamino]ethylphosphonic acid (PubChem CID 157041437) has the molecular formula C20H24N5O5P and a molecular weight of 445.42 g/mol. Its IUPAC name is 2-[2-[[6-hydroxy-7-methoxy-2-[(E)-2-pyridin-3-ylethenyl]quinazolin-4-yl]amino]ethylamino]ethylphosphonic acid.
| Compound Name | 2-[2-[[6-hydroxy-7-methoxy-2-[(E)-2-pyridin-3-ylethenyl]quinazolin-4-yl]amino]ethylamino]ethylphosphonic acid |
|---|---|
| PubChem CID | 157041437 |
| Molecular Formula | C20H24N5O5P |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-[2-[[6-hydroxy-7-methoxy-2-[(E)-2-pyridin-3-ylethenyl]quinazolin-4-yl]amino]ethylamino]ethylphosphonic acid |
| SMILES | COc1cc2nc(/C=C/c3cccnc3)nc(NCCNCCP(=O)(O)O)c2cc1O |
| InChI | InChI=1S/C20H24N5O5P/c1-30-18-12-16-15(11-17(18)26)20(23-8-7-21-9-10-31(27,28)29)25-19(24-16)5-4-14-3-2-6-22-13-14/h2-6,11-13,21,26H,7-10H2,1H3,(H,23,24,25)(H2,27,28,29)/b5-4+ |
| InChIKey | LDOSIWYSHMPVQG-SNAWJCMRSA-N |
| XLogP | 2.09 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|