C13H20F3NO2 — CID 157041510
ethane;3-ethyl-1-(2-methoxyethyl)-5-(trifluoromethyl)pyridin-2-one (PubChem CID 157041510) has the molecular formula C13H20F3NO2 and a molecular weight of 279.30 g/mol. Its IUPAC name is ethane;3-ethyl-1-(2-methoxyethyl)-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | ethane;3-ethyl-1-(2-methoxyethyl)-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 157041510 |
| Molecular Formula | C13H20F3NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | ethane;3-ethyl-1-(2-methoxyethyl)-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC.CCc1cc(C(F)(F)F)cn(CCOC)c1=O |
| InChI | InChI=1S/C11H14F3NO2.C2H6/c1-3-8-6-9(11(12,13)14)7-15(10(8)16)4-5-17-2;1-2/h6-7H,3-5H2,1-2H3;1-2H3 |
| InChIKey | ITXLTCAHBMIAEP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |