C19H32F3NO3 — CID 157041539
ethane;1-(4-methoxyoxan-3-yl)-3-propan-2-yl-5-(trifluoromethyl)pyridin-2-one (PubChem CID 157041539) has the molecular formula C19H32F3NO3 and a molecular weight of 379.46 g/mol. Its IUPAC name is ethane;1-(4-methoxyoxan-3-yl)-3-propan-2-yl-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | ethane;1-(4-methoxyoxan-3-yl)-3-propan-2-yl-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 157041539 |
| Molecular Formula | C19H32F3NO3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | ethane;1-(4-methoxyoxan-3-yl)-3-propan-2-yl-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC.CC.COC1CCOCC1n1cc(C(F)(F)F)cc(C(C)C)c1=O |
| InChI | InChI=1S/C15H20F3NO3.2C2H6/c1-9(2)11-6-10(15(16,17)18)7-19(14(11)20)12-8-22-5-4-13(12)21-3;2*1-2/h6-7,9,12-13H,4-5,8H2,1-3H3;2*1-2H3 |
| InChIKey | IMVRRUTXCDXEAV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |