About 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one
3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 157041685) has the molecular formula C13H13F3N2O3S
and a molecular weight of 334.32 g/mol. Its IUPAC name is 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 157041685 |
| Molecular Formula | C13H13F3N2O3S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CO[C@@H]1CCOC[C@@H]1n1cc(C(F)(F)F)cc(N=C=S)c1=O |
| InChI | InChI=1S/C13H13F3N2O3S/c1-20-11-2-3-21-6-10(11)18-5-8(13(14,15)16)4-9(12(18)19)17-7-22/h4-5,10-11H,2-3,6H2,1H3/t10-,11+/m0/s1 |
| InChIKey | NLSLQOSOCRBZKH-WDEREUQCSA-N |
| XLogP | 2.58 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one (CID 157041685) is 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one is CO[C@@H]1CCOC[C@@H]1n1cc(C(F)(F)F)cc(N=C=S)c1=O.
What is the InChIKey of 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is NLSLQOSOCRBZKH-WDEREUQCSA-N. The full InChI is InChI=1S/C13H13F3N2O3S/c1-20-11-2-3-21-6-10(11)18-5-8(13(14,15)16)4-9(12(18)19)17-7-22/h4-5,10-11H,2-3,6H2,1H3/t10-,11+/m0/s1.
What are the key properties of 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one?
3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 334.32 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isothiocyanato-1-[(3S,4R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 157041685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).