C24H22ClF5N8O3 — CID 157041778
N-[4-[7-chloro-2-[[1-(3-methoxycyclobutyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]amino]-1-methylimidazo[4,5-b]pyridin-6-yl]oxy-2-pyridinyl]acetamide (PubChem CID 157041778) has the molecular formula C24H22ClF5N8O3 and a molecular weight of 600.94 g/mol. Its IUPAC name is N-[4-[7-chloro-2-[[1-(3-methoxycyclobutyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]amino]-1-methylimidazo[4,5-b]pyridin-6-yl]oxy-2-pyridinyl]acetamide.
| Compound Name | N-[4-[7-chloro-2-[[1-(3-methoxycyclobutyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]amino]-1-methylimidazo[4,5-b]pyridin-6-yl]oxy-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 157041778 |
| Molecular Formula | C24H22ClF5N8O3 |
| Molecular Weight | 600.94 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | N-[4-[7-chloro-2-[[1-(3-methoxycyclobutyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]amino]-1-methylimidazo[4,5-b]pyridin-6-yl]oxy-2-pyridinyl]acetamide |
| SMILES | COC1CC(n2nc(Nc3nc4ncc(Oc5ccnc(NC(C)=O)c5)c(Cl)c4n3C)cc2C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C24H22ClF5N8O3/c1-11(39)33-17-8-13(4-5-31-17)41-15-10-32-21-20(19(15)25)37(2)22(35-21)34-18-9-16(23(26,27)24(28,29)30)38(36-18)12-6-14(7-12)40-3/h4-5,8-10,12,14H,6-7H2,1-3H3,(H,31,33,39)(H,32,34,35,36) |
| InChIKey | SQTMUEPHSBERKL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.94 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|