C10H14F5N3O — CID 157041834
1-(1-methoxybutan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine (PubChem CID 157041834) has the molecular formula C10H14F5N3O and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-(1-methoxybutan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine.
| Compound Name | 1-(1-methoxybutan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 157041834 |
| Molecular Formula | C10H14F5N3O |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-(1-methoxybutan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine |
| SMILES | CCC(COC)n1nc(N)cc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F5N3O/c1-3-6(5-19-2)18-7(4-8(16)17-18)9(11,12)10(13,14)15/h4,6H,3,5H2,1-2H3,(H2,16,17) |
| InChIKey | WDZKYFDLLCEKDN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|