C24H23F5N8O3 — CID 157041891
N-[4-[1,7-dimethyl-2-[[1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]amino]imidazo[4,5-b]pyridin-6-yl]oxy-2-pyridinyl]acetamide (PubChem CID 157041891) has the molecular formula C24H23F5N8O3 and a molecular weight of 566.49 g/mol. Its IUPAC name is N-[4-[1,7-dimethyl-2-[[1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]amino]imidazo[4,5-b]pyridin-6-yl]oxy-2-pyridinyl]acetamide.
| Compound Name | N-[4-[1,7-dimethyl-2-[[1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]amino]imidazo[4,5-b]pyridin-6-yl]oxy-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 157041891 |
| Molecular Formula | C24H23F5N8O3 |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | N-[4-[1,7-dimethyl-2-[[1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-yl]amino]imidazo[4,5-b]pyridin-6-yl]oxy-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(Oc2cnc3nc(Nc4cc(C(F)(F)C(F)(F)F)n([C@H]5CCOC5)n4)n(C)c3c2C)ccn1 |
| InChI | InChI=1S/C24H23F5N8O3/c1-12-16(40-15-4-6-30-18(8-15)32-13(2)38)10-31-21-20(12)36(3)22(34-21)33-19-9-17(23(25,26)24(27,28)29)37(35-19)14-5-7-39-11-14/h4,6,8-10,14H,5,7,11H2,1-3H3,(H,30,32,38)(H,31,33,34,35)/t14-/m0/s1 |
| InChIKey | KBVLBMKMSCOZOE-AWEZNQCLSA-N |
| XLogP | 4.98 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|