About N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide
N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide (PubChem CID 157042009) has the molecular formula C13H15F3N2O4
and a molecular weight of 320.27 g/mol. Its IUPAC name is N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide.
Molecular Properties
| Compound Name | N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide |
| PubChem CID | 157042009 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(F)(F)F)cn([C@H]2COCC[C@H]2O)c1=O |
| InChI | InChI=1S/C13H15F3N2O4/c1-7(19)17-9-4-8(13(14,15)16)5-18(12(9)21)10-6-22-3-2-11(10)20/h4-5,10-11,20H,2-3,6H2,1H3,(H,17,19)/t10-,11+/m0/s1 |
| InChIKey | DKKRDWMUAPQZAF-WDEREUQCSA-N |
| XLogP | 1.15 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide?
The IUPAC name of N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide (CID 157042009) is N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide.
What is the SMILES notation for N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide?
The canonical SMILES for N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide is CC(=O)Nc1cc(C(F)(F)F)cn([C@H]2COCC[C@H]2O)c1=O.
What is the InChIKey of N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide?
The InChIKey is DKKRDWMUAPQZAF-WDEREUQCSA-N. The full InChI is InChI=1S/C13H15F3N2O4/c1-7(19)17-9-4-8(13(14,15)16)5-18(12(9)21)10-6-22-3-2-11(10)20/h4-5,10-11,20H,2-3,6H2,1H3,(H,17,19)/t10-,11+/m0/s1.
What are the key properties of N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide?
N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide has a molecular weight of 320.27 g/mol, XLogP of 1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(3S,4R)-4-hydroxyoxan-3-yl]-2-oxo-5-(trifluoromethyl)-3-pyridinyl]acetamide is sourced from PubChem (CID 157042009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).