C10H12F5N3O — CID 157042125
1-(3-methoxycyclobutyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine (PubChem CID 157042125) has the molecular formula C10H12F5N3O and a molecular weight of 285.22 g/mol. Its IUPAC name is 1-(3-methoxycyclobutyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine.
| Compound Name | 1-(3-methoxycyclobutyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 157042125 |
| Molecular Formula | C10H12F5N3O |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 1-(3-methoxycyclobutyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine |
| SMILES | COC1CC(n2nc(N)cc2C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H12F5N3O/c1-19-6-2-5(3-6)18-7(4-8(16)17-18)9(11,12)10(13,14)15/h4-6H,2-3H2,1H3,(H2,16,17) |
| InChIKey | YIWFNRJICXKPEH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|