C9H10F5N3O — CID 157042382
1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine (PubChem CID 157042382) has the molecular formula C9H10F5N3O and a molecular weight of 271.19 g/mol. Its IUPAC name is 1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine.
| Compound Name | 1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 157042382 |
| Molecular Formula | C9H10F5N3O |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 1-[(3S)-oxolan-3-yl]-5-(1,1,2,2,2-pentafluoroethyl)pyrazol-3-amine |
| SMILES | Nc1cc(C(F)(F)C(F)(F)F)n([C@H]2CCOC2)n1 |
| InChI | InChI=1S/C9H10F5N3O/c10-8(11,9(12,13)14)6-3-7(15)16-17(6)5-1-2-18-4-5/h3,5H,1-2,4H2,(H2,15,16)/t5-/m0/s1 |
| InChIKey | NOFFYGKXBFTQRU-YFKPBYRVSA-N |
| XLogP | 2.08 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|