About N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine
N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine (PubChem CID 157042715) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine.
Molecular Properties
| Compound Name | N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine |
| PubChem CID | 157042715 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine |
| SMILES | CC=Nc1cnnc(C(C)CC)n1 |
| InChI | InChI=1S/C9H14N4/c1-4-7(3)9-12-8(10-5-2)6-11-13-9/h5-7H,4H2,1-3H3 |
| InChIKey | OBSYFAPFDYTZIX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine?
The IUPAC name of N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine (CID 157042715) is N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine.
What is the SMILES notation for N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine?
The canonical SMILES for N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine is CC=Nc1cnnc(C(C)CC)n1.
What is the InChIKey of N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine?
The InChIKey is OBSYFAPFDYTZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c1-4-7(3)9-12-8(10-5-2)6-11-13-9/h5-7H,4H2,1-3H3.
What are the key properties of N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine?
N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine has a molecular weight of 178.24 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-butan-2-yl-1,2,4-triazin-5-yl)ethanimine is sourced from PubChem (CID 157042715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).