C19H20N6 — CID 157043388
2-(4-aminophenyl)-N-pyridin-4-yl-1H-imidazo[4,5-b]pyridin-6-amine;ethane (PubChem CID 157043388) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-pyridin-4-yl-1H-imidazo[4,5-b]pyridin-6-amine;ethane.
| Compound Name | 2-(4-aminophenyl)-N-pyridin-4-yl-1H-imidazo[4,5-b]pyridin-6-amine;ethane |
|---|---|
| PubChem CID | 157043388 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-(4-aminophenyl)-N-pyridin-4-yl-1H-imidazo[4,5-b]pyridin-6-amine;ethane |
| SMILES | CC.Nc1ccc(-c2nc3ncc(Nc4ccncc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C17H14N6.C2H6/c18-12-3-1-11(2-4-12)16-22-15-9-14(10-20-17(15)23-16)21-13-5-7-19-8-6-13;1-2/h1-10H,18H2,(H,19,21)(H,20,22,23);1-2H3 |
| InChIKey | LVQDGYDEHCRUDK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|