C26H19FN6O — CID 157044112
4-[(6-fluoroquinolin-4-yl)amino]-N-[6-(pyridin-4-ylamino)-3-pyridinyl]benzamide (PubChem CID 157044112) has the molecular formula C26H19FN6O and a molecular weight of 450.48 g/mol. Its IUPAC name is 4-[(6-fluoroquinolin-4-yl)amino]-N-[6-(pyridin-4-ylamino)-3-pyridinyl]benzamide.
| Compound Name | 4-[(6-fluoroquinolin-4-yl)amino]-N-[6-(pyridin-4-ylamino)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 157044112 |
| Molecular Formula | C26H19FN6O |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 4-[(6-fluoroquinolin-4-yl)amino]-N-[6-(pyridin-4-ylamino)-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(Nc2ccncc2)nc1)c1ccc(Nc2ccnc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C26H19FN6O/c27-18-3-7-23-22(15-18)24(11-14-29-23)31-19-4-1-17(2-5-19)26(34)33-21-6-8-25(30-16-21)32-20-9-12-28-13-10-20/h1-16H,(H,29,31)(H,33,34)(H,28,30,32) |
| InChIKey | DYSWTNSSGFOBLC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |