C23H38N2O4 — CID 15704417
(Z)-7-[(1R,2S)-2-[[[2-(4-cyclohexylbutanoylamino)acetyl]amino]methyl]cyclopropyl]hept-5-enoic acid (PubChem CID 15704417) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol. Its IUPAC name is (Z)-7-[(1R,2S)-2-[[[2-(4-cyclohexylbutanoylamino)acetyl]amino]methyl]cyclopropyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S)-2-[[[2-(4-cyclohexylbutanoylamino)acetyl]amino]methyl]cyclopropyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 15704417 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | (Z)-7-[(1R,2S)-2-[[[2-(4-cyclohexylbutanoylamino)acetyl]amino]methyl]cyclopropyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1C[C@@H]1CNC(=O)CNC(=O)CCCC1CCCCC1 |
| InChI | InChI=1S/C23H38N2O4/c26-21(13-8-11-18-9-4-3-5-10-18)25-17-22(27)24-16-20-15-19(20)12-6-1-2-7-14-23(28)29/h1,6,18-20H,2-5,7-17H2,(H,24,27)(H,25,26)(H,28,29)/b6-1-/t19-,20-/m1/s1 |
| InChIKey | JMUQRRCKJCJNJM-LIXQHWFTSA-N |
| XLogP | 3.81 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|