About 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine
2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine (PubChem CID 157044456) has the molecular formula C15H15ClF3N3O
and a molecular weight of 345.75 g/mol. Its IUPAC name is 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine |
| PubChem CID | 157044456 |
| Molecular Formula | C15H15ClF3N3O |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine |
| SMILES | Cc1cc2c(OCC3CC(C(F)(F)F)C3)nc(Cl)nc2nc1C |
| InChI | InChI=1S/C15H15ClF3N3O/c1-7-3-11-12(20-8(7)2)21-14(16)22-13(11)23-6-9-4-10(5-9)15(17,18)19/h3,9-10H,4-6H2,1-2H3 |
| InChIKey | DZQAROMDBZHVFJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine?
The IUPAC name of 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine (CID 157044456) is 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine.
What is the SMILES notation for 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine?
The canonical SMILES for 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine is Cc1cc2c(OCC3CC(C(F)(F)F)C3)nc(Cl)nc2nc1C.
What is the InChIKey of 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine?
The InChIKey is DZQAROMDBZHVFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClF3N3O/c1-7-3-11-12(20-8(7)2)21-14(16)22-13(11)23-6-9-4-10(5-9)15(17,18)19/h3,9-10H,4-6H2,1-2H3.
What are the key properties of 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine?
2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine has a molecular weight of 345.75 g/mol, XLogP of 4.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,7-dimethyl-4-[[3-(trifluoromethyl)cyclobutyl]methoxy]pyrido[2,3-d]pyrimidine is sourced from PubChem (CID 157044456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).