C22H20F3N7O — CID 157044457
(2S)-4-[6,7-dimethyl-4-(3,4,5-trifluorophenyl)pteridin-2-yl]-2-(1-methylpyrazol-4-yl)morpholine (PubChem CID 157044457) has the molecular formula C22H20F3N7O and a molecular weight of 455.44 g/mol. Its IUPAC name is (2S)-4-[6,7-dimethyl-4-(3,4,5-trifluorophenyl)pteridin-2-yl]-2-(1-methylpyrazol-4-yl)morpholine.
| Compound Name | (2S)-4-[6,7-dimethyl-4-(3,4,5-trifluorophenyl)pteridin-2-yl]-2-(1-methylpyrazol-4-yl)morpholine |
|---|---|
| PubChem CID | 157044457 |
| Molecular Formula | C22H20F3N7O |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (2S)-4-[6,7-dimethyl-4-(3,4,5-trifluorophenyl)pteridin-2-yl]-2-(1-methylpyrazol-4-yl)morpholine |
| SMILES | Cc1nc2nc(N3CCO[C@@H](c4cnn(C)c4)C3)nc(-c3cc(F)c(F)c(F)c3)c2nc1C |
| InChI | InChI=1S/C22H20F3N7O/c1-11-12(2)28-21-20(27-11)19(13-6-15(23)18(25)16(24)7-13)29-22(30-21)32-4-5-33-17(10-32)14-8-26-31(3)9-14/h6-9,17H,4-5,10H2,1-3H3/t17-/m1/s1 |
| InChIKey | YBWLUWCABQKCKX-QGZVFWFLSA-N |
| XLogP | 3.43 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|