About 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole
6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole (PubChem CID 157044684) has the molecular formula C22H27F3N6O
and a molecular weight of 448.49 g/mol. Its IUPAC name is 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole.
Molecular Properties
| Compound Name | 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole |
| PubChem CID | 157044684 |
| Molecular Formula | C22H27F3N6O |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole |
| SMILES | Cc1nc2ncnc(C3CC(C(F)(F)F)C3)c2nc1C.Cn1cc(C2CCCCO2)cn1 |
| InChI | InChI=1S/C13H13F3N4.C9H14N2O/c1-6-7(2)20-12-11(19-6)10(17-5-18-12)8-3-9(4-8)13(14,15)16;1-11-7-8(6-10-11)9-4-2-3-5-12-9/h5,8-9H,3-4H2,1-2H3;6-7,9H,2-5H2,1H3 |
| InChIKey | HFDRLFNYJGODPL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole?
The IUPAC name of 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole (CID 157044684) is 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole.
What is the SMILES notation for 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole?
The canonical SMILES for 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole is Cc1nc2ncnc(C3CC(C(F)(F)F)C3)c2nc1C.Cn1cc(C2CCCCO2)cn1.
What is the InChIKey of 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole?
The InChIKey is HFDRLFNYJGODPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N4.C9H14N2O/c1-6-7(2)20-12-11(19-6)10(17-5-18-12)8-3-9(4-8)13(14,15)16;1-11-7-8(6-10-11)9-4-2-3-5-12-9/h5,8-9H,3-4H2,1-2H3;6-7,9H,2-5H2,1H3.
What are the key properties of 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole?
6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole has a molecular weight of 448.49 g/mol, XLogP of 4.75, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-4-[3-(trifluoromethyl)cyclobutyl]pteridine;1-methyl-4-(oxan-2-yl)pyrazole is sourced from PubChem (CID 157044684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).