C16H19N7O — CID 157045930
4-(6,7-dimethylpteridin-2-yl)-2-(1-methylpyrazol-4-yl)morpholine (PubChem CID 157045930) has the molecular formula C16H19N7O and a molecular weight of 325.38 g/mol. Its IUPAC name is 4-(6,7-dimethylpteridin-2-yl)-2-(1-methylpyrazol-4-yl)morpholine.
| Compound Name | 4-(6,7-dimethylpteridin-2-yl)-2-(1-methylpyrazol-4-yl)morpholine |
|---|---|
| PubChem CID | 157045930 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-(6,7-dimethylpteridin-2-yl)-2-(1-methylpyrazol-4-yl)morpholine |
| SMILES | Cc1nc2cnc(N3CCOC(c4cnn(C)c4)C3)nc2nc1C |
| InChI | InChI=1S/C16H19N7O/c1-10-11(2)20-15-13(19-10)7-17-16(21-15)23-4-5-24-14(9-23)12-6-18-22(3)8-12/h6-8,14H,4-5,9H2,1-3H3 |
| InChIKey | SJPXTZVWICMOQS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |