C10H9F2N3O — CID 157046445
[5-(2,4-difluorophenyl)-3-methyltriazol-4-yl]methanol (PubChem CID 157046445) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is [5-(2,4-difluorophenyl)-3-methyltriazol-4-yl]methanol.
| Compound Name | [5-(2,4-difluorophenyl)-3-methyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 157046445 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | [5-(2,4-difluorophenyl)-3-methyltriazol-4-yl]methanol |
| SMILES | Cn1nnc(-c2ccc(F)cc2F)c1CO |
| InChI | InChI=1S/C10H9F2N3O/c1-15-9(5-16)10(13-14-15)7-3-2-6(11)4-8(7)12/h2-4,16H,5H2,1H3 |
| InChIKey | ZIBXXIAWYNPOMS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |