C13H21N3S — CID 157046698
N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane (PubChem CID 157046698) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane.
| Compound Name | N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane |
|---|---|
| PubChem CID | 157046698 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane |
| SMILES | CC(C)C.CC(NS)c1ccc2nccn2c1 |
| InChI | InChI=1S/C9H11N3S.C4H10/c1-7(11-13)8-2-3-9-10-4-5-12(9)6-8;1-4(2)3/h2-7,11,13H,1H3;4H,1-3H3 |
| InChIKey | PQQQKVGRYPVZMA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|