About N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane
N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane (PubChem CID 157046698) has the molecular formula C13H21N3S
and a molecular weight of 251.40 g/mol. Its IUPAC name is N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane.
Molecular Properties
| Compound Name | N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane |
| PubChem CID | 157046698 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane |
| SMILES | CC(C)C.CC(NS)c1ccc2nccn2c1 |
| InChI | InChI=1S/C9H11N3S.C4H10/c1-7(11-13)8-2-3-9-10-4-5-12(9)6-8;1-4(2)3/h2-7,11,13H,1H3;4H,1-3H3 |
| InChIKey | PQQQKVGRYPVZMA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane?
The IUPAC name of N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane (CID 157046698) is N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane.
What is the SMILES notation for N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane?
The canonical SMILES for N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane is CC(C)C.CC(NS)c1ccc2nccn2c1.
What is the InChIKey of N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane?
The InChIKey is PQQQKVGRYPVZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3S.C4H10/c1-7(11-13)8-2-3-9-10-4-5-12(9)6-8;1-4(2)3/h2-7,11,13H,1H3;4H,1-3H3.
What are the key properties of N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane?
N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane has a molecular weight of 251.40 g/mol, XLogP of 3.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-imidazo[1,2-a]pyridin-6-ylethyl)thiohydroxylamine;2-methylpropane is sourced from PubChem (CID 157046698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).