C25H22F7N7O4 — CID 157046731
(3S)-3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[4-[(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)amino]-1H-indazole-6-carbonyl]amino]acetyl]amino]propanoic acid (PubChem CID 157046731) has the molecular formula C25H22F7N7O4 and a molecular weight of 617.48 g/mol. Its IUPAC name is (3S)-3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[4-[(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)amino]-1H-indazole-6-carbonyl]amino]acetyl]amino]propanoic acid.
| Compound Name | (3S)-3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[4-[(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)amino]-1H-indazole-6-carbonyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 157046731 |
| Molecular Formula | C25H22F7N7O4 |
| Molecular Weight | 617.48 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | (3S)-3-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[[4-[(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)amino]-1H-indazole-6-carbonyl]amino]acetyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)CNC(=O)c1cc(NC2=NCC(F)CN2)c2cn[nH]c2c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22F7N7O4/c26-15-7-34-23(35-8-15)38-18-3-12(4-19-16(18)9-36-39-19)22(43)33-10-20(40)37-17(6-21(41)42)11-1-13(24(27,28)29)5-14(2-11)25(30,31)32/h1-5,9,15,17H,6-8,10H2,(H,33,43)(H,36,39)(H,37,40)(H,41,42)(H2,34,35,38)/t17-/m0/s1 |
| InChIKey | HZKFGZIJFYFAGL-KRWDZBQOSA-N |
| XLogP | 3.37 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |