About 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine
1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine (PubChem CID 157047279) has the molecular formula C15H14BrF3N4
and a molecular weight of 387.20 g/mol. Its IUPAC name is 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine |
| PubChem CID | 157047279 |
| Molecular Formula | C15H14BrF3N4 |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine |
| SMILES | CNCC1=NC(c2cc3c(Br)cccc3n2CC(F)(F)F)=NC1 |
| InChI | InChI=1S/C15H14BrF3N4/c1-20-6-9-7-21-14(22-9)13-5-10-11(16)3-2-4-12(10)23(13)8-15(17,18)19/h2-5,20H,6-8H2,1H3 |
| InChIKey | QOAKLPJYIGBGEG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine?
The IUPAC name of 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine (CID 157047279) is 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine?
The canonical SMILES for 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine is CNCC1=NC(c2cc3c(Br)cccc3n2CC(F)(F)F)=NC1.
What is the InChIKey of 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine?
The InChIKey is QOAKLPJYIGBGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrF3N4/c1-20-6-9-7-21-14(22-9)13-5-10-11(16)3-2-4-12(10)23(13)8-15(17,18)19/h2-5,20H,6-8H2,1H3.
What are the key properties of 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine?
1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine has a molecular weight of 387.20 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[4-bromo-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]-N-methylmethanamine is sourced from PubChem (CID 157047279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).