C24H27F4N7 — CID 157047857
(1Z)-3-N-[[2-[4-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]methyl]-2-[(3-fluorocyclopentyl)iminomethyl]buta-1,3-diene-1,3-diamine (PubChem CID 157047857) has the molecular formula C24H27F4N7 and a molecular weight of 489.52 g/mol. Its IUPAC name is (1Z)-3-N-[[2-[4-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]methyl]-2-[(3-fluorocyclopentyl)iminomethyl]buta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-3-N-[[2-[4-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]methyl]-2-[(3-fluorocyclopentyl)iminomethyl]buta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 157047857 |
| Molecular Formula | C24H27F4N7 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (1Z)-3-N-[[2-[4-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]-4H-imidazol-5-yl]methyl]-2-[(3-fluorocyclopentyl)iminomethyl]buta-1,3-diene-1,3-diamine |
| SMILES | C=C(NCC1=NC(c2cc3c(N)cccc3n2CC(F)(F)F)=NC1)C(=C/N)/C=N/C1CCC(F)C1 |
| InChI | InChI=1S/C24H27F4N7/c1-14(15(9-29)10-32-17-6-5-16(25)7-17)31-11-18-12-33-23(34-18)22-8-19-20(30)3-2-4-21(19)35(22)13-24(26,27)28/h2-4,8-10,16-17,31H,1,5-7,11-13,29-30H2/b15-9+,32-10+ |
| InChIKey | XLHUXWFFTYNWLE-FAVLOAEOSA-N |
| XLogP | 3.89 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|