C15H24O6 — CID 15704847
2,4,6-tris(prop-2-enoxy)cyclohexane-1,3,5-triol (PubChem CID 15704847) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2,4,6-tris(prop-2-enoxy)cyclohexane-1,3,5-triol.
| Compound Name | 2,4,6-tris(prop-2-enoxy)cyclohexane-1,3,5-triol |
|---|---|
| PubChem CID | 15704847 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2,4,6-tris(prop-2-enoxy)cyclohexane-1,3,5-triol |
| SMILES | C=CCOC1C(O)C(OCC=C)C(O)C(OCC=C)C1O |
| InChI | InChI=1S/C15H24O6/c1-4-7-19-13-10(16)14(20-8-5-2)12(18)15(11(13)17)21-9-6-3/h4-6,10-18H,1-3,7-9H2 |
| InChIKey | UHEWGVHRSBQHND-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|