About molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide
molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide (PubChem CID 157048845) has the molecular formula C16H38N2O5
and a molecular weight of 338.49 g/mol. Its IUPAC name is molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide.
Molecular Properties
| Compound Name | molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide |
| PubChem CID | 157048845 |
| Molecular Formula | C16H38N2O5 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide |
| SMILES | CC(C)NCCOCCOCCOCCOCC(=O)NC(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C16H34N2O5.2H2/c1-14(2)17-5-6-20-7-8-21-9-10-22-11-12-23-13-16(19)18-15(3)4;;/h14-15,17H,5-13H2,1-4H3,(H,18,19);2*1H |
| InChIKey | OCXHNXXNVNSDAG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide?
The IUPAC name of molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide (CID 157048845) is molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide.
What is the SMILES notation for molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide?
The canonical SMILES for molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide is CC(C)NCCOCCOCCOCCOCC(=O)NC(C)C.[H][H].[H][H].
What is the InChIKey of molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide?
The InChIKey is OCXHNXXNVNSDAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2O5.2H2/c1-14(2)17-5-6-20-7-8-21-9-10-22-11-12-23-13-16(19)18-15(3)4;;/h14-15,17H,5-13H2,1-4H3,(H,18,19);2*1H.
What are the key properties of molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide?
molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide has a molecular weight of 338.49 g/mol, XLogP of 1.07, 16 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-propan-2-yl-2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetamide is sourced from PubChem (CID 157048845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).