C24H36O6 — CID 15704917
2,3:5,6-Di-O-1-Cyclohexylieden-1,4-cyclohexandiallylether (PubChem CID 15704917) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol.
| Compound Name | 2,3:5,6-Di-O-1-Cyclohexylieden-1,4-cyclohexandiallylether |
|---|---|
| PubChem CID | 15704917 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | — |
| SMILES | C=CCOC1C2OC3(CCCCC3)OC2C(OCC=C)C2OC3(CCCCC3)OC12 |
| InChI | InChI=1S/C24H36O6/c1-3-15-25-17-19-21(29-23(27-19)11-7-5-8-12-23)18(26-16-4-2)22-20(17)28-24(30-22)13-9-6-10-14-24/h3-4,17-22H,1-2,5-16H2 |
| InChIKey | FSCTWOGSNXMLPZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|