C23H23N4O+ — CID 157049297
4-[3-(4-piperazin-4-ium-1-ylphenyl)-1H-indazol-6-yl]phenol (PubChem CID 157049297) has the molecular formula C23H23N4O+ and a molecular weight of 371.46 g/mol. Its IUPAC name is 4-[3-(4-piperazin-4-ium-1-ylphenyl)-1H-indazol-6-yl]phenol.
| Compound Name | 4-[3-(4-piperazin-4-ium-1-ylphenyl)-1H-indazol-6-yl]phenol |
|---|---|
| PubChem CID | 157049297 |
| Molecular Formula | C23H23N4O+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 4-[3-(4-piperazin-4-ium-1-ylphenyl)-1H-indazol-6-yl]phenol |
| SMILES | Oc1ccc(-c2ccc3c(-c4ccc(N5CC[NH2+]CC5)cc4)n[nH]c3c2)cc1 |
| InChI | InChI=1S/C23H22N4O/c28-20-8-3-16(4-9-20)18-5-10-21-22(15-18)25-26-23(21)17-1-6-19(7-2-17)27-13-11-24-12-14-27/h1-10,15,24,28H,11-14H2,(H,25,26)/p+1 |
| InChIKey | OYKIIJTXTXJYKZ-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |