C47H61Cl2N2PRu — CID 157049904
[2-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]cyclohexyl]-dicyclohexylphosphane;dichloro(2-phenylethenylidene)ruthenium (PubChem CID 157049904) has the molecular formula C47H61Cl2N2PRu and a molecular weight of 856.97 g/mol. Its IUPAC name is [2-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]cyclohexyl]-dicyclohexylphosphane;dichloro(2-phenylethenylidene)ruthenium.
| Compound Name | [2-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]cyclohexyl]-dicyclohexylphosphane;dichloro(2-phenylethenylidene)ruthenium |
|---|---|
| PubChem CID | 157049904 |
| Molecular Formula | C47H61Cl2N2PRu |
| Molecular Weight | 856.97 g/mol |
| Exact Mass | 856.30 |
| IUPAC Name | [2-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]cyclohexyl]-dicyclohexylphosphane;dichloro(2-phenylethenylidene)ruthenium |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)C2=C2CCCCC2P(C2CCCCC2)C2CCCCC2)c(C)c1.Cl[Ru](Cl)=C=Cc1ccccc1 |
| InChI | InChI=1S/C39H55N2P.C8H6.2ClH.Ru/c1-27-23-29(3)37(30(4)24-27)40-21-22-41(38-31(5)25-28(2)26-32(38)6)39(40)35-19-13-14-20-36(35)42(33-15-9-7-10-16-33)34-17-11-8-12-18-34;1-2-8-6-4-3-5-7-8;;;/h21-26,33-34,36H,7-20H2,1-6H3;2-7H;2*1H;/q;;;;+2/p-2 |
| InChIKey | HYAWEWONGFIDRT-UHFFFAOYSA-L |
| XLogP | 14.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.97 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|