About 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine
4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine (PubChem CID 157050390) has the molecular formula C19H21IN4O4S
and a molecular weight of 528.37 g/mol. Its IUPAC name is 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine.
Molecular Properties
| Compound Name | 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine |
| PubChem CID | 157050390 |
| Molecular Formula | C19H21IN4O4S |
| Molecular Weight | 528.37 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine |
| SMILES | COc1cc(I)c(OC)nn1.COc1cc(SCc2ccccc2)c(OC)nn1 |
| InChI | InChI=1S/C13H14N2O2S.C6H7IN2O2/c1-16-12-8-11(13(17-2)15-14-12)18-9-10-6-4-3-5-7-10;1-10-5-3-4(7)6(11-2)9-8-5/h3-8H,9H2,1-2H3;3H,1-2H3 |
| InChIKey | AADASYDVMPCDBU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine?
The IUPAC name of 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine (CID 157050390) is 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine.
What is the SMILES notation for 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine?
The canonical SMILES for 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine is COc1cc(I)c(OC)nn1.COc1cc(SCc2ccccc2)c(OC)nn1.
What is the InChIKey of 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine?
The InChIKey is AADASYDVMPCDBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S.C6H7IN2O2/c1-16-12-8-11(13(17-2)15-14-12)18-9-10-6-4-3-5-7-10;1-10-5-3-4(7)6(11-2)9-8-5/h3-8H,9H2,1-2H3;3H,1-2H3.
What are the key properties of 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine?
4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine has a molecular weight of 528.37 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanyl-3,6-dimethoxypyridazine;4-iodo-3,6-dimethoxypyridazine is sourced from PubChem (CID 157050390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).