C19H19ClN2O2S2 — CID 157050478
[5-[2-(5-chlorothiophen-2-yl)ethyl]-3-(oxan-4-yl)pyrazol-1-yl]-thiophen-3-ylmethanone (PubChem CID 157050478) has the molecular formula C19H19ClN2O2S2 and a molecular weight of 406.96 g/mol. Its IUPAC name is [5-[2-(5-chlorothiophen-2-yl)ethyl]-3-(oxan-4-yl)pyrazol-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [5-[2-(5-chlorothiophen-2-yl)ethyl]-3-(oxan-4-yl)pyrazol-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 157050478 |
| Molecular Formula | C19H19ClN2O2S2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | [5-[2-(5-chlorothiophen-2-yl)ethyl]-3-(oxan-4-yl)pyrazol-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)n1nc(C2CCOCC2)cc1CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C19H19ClN2O2S2/c20-18-4-3-16(26-18)2-1-15-11-17(13-5-8-24-9-6-13)21-22(15)19(23)14-7-10-25-12-14/h3-4,7,10-13H,1-2,5-6,8-9H2 |
| InChIKey | ZHIFMQACRIVOJO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |