About 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium
1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium (PubChem CID 157050631) has the molecular formula C16H36N4+2
and a molecular weight of 284.49 g/mol. Its IUPAC name is 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium.
Molecular Properties
| Compound Name | 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium |
| PubChem CID | 157050631 |
| Molecular Formula | C16H36N4+2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium |
| SMILES | CC[N+]1(C)CCN(C)CC1.CC[N+]12CCN(CC1)CC2 |
| InChI | InChI=1S/C8H17N2.C8H19N2/c1-2-10-6-3-9(4-7-10)5-8-10;1-4-10(3)7-5-9(2)6-8-10/h2-8H2,1H3;4-8H2,1-3H3/q2*+1 |
| InChIKey | AADVHPFWHMUOAH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium?
The IUPAC name of 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium (CID 157050631) is 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium.
What is the SMILES notation for 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium?
The canonical SMILES for 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium is CC[N+]1(C)CCN(C)CC1.CC[N+]12CCN(CC1)CC2.
What is the InChIKey of 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium?
The InChIKey is AADVHPFWHMUOAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N2.C8H19N2/c1-2-10-6-3-9(4-7-10)5-8-10;1-4-10(3)7-5-9(2)6-8-10/h2-8H2,1H3;4-8H2,1-3H3/q2*+1.
What are the key properties of 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium?
1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium has a molecular weight of 284.49 g/mol, XLogP of 0.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-aza-1-azoniabicyclo[2.2.2]octane;1-ethyl-1,4-dimethylpiperazin-1-ium is sourced from PubChem (CID 157050631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).