C55H84N10O5S3 — CID 157050964
1,3,4,5-tetramethylpyrazole;bis(2,4,5-trimethyl-1,3-oxazole);tris(3,4,5-trimethyl-1,2-oxazole);bis(2,4,5-trimethyl-1,3-thiazole);3,4,5-trimethyl-1,2-thiazole (PubChem CID 157050964) has the molecular formula C55H84N10O5S3 and a molecular weight of 1061.54 g/mol. Its IUPAC name is 1,3,4,5-tetramethylpyrazole;bis(2,4,5-trimethyl-1,3-oxazole);tris(3,4,5-trimethyl-1,2-oxazole);bis(2,4,5-trimethyl-1,3-thiazole);3,4,5-trimethyl-1,2-thiazole.
| Compound Name | 1,3,4,5-tetramethylpyrazole;bis(2,4,5-trimethyl-1,3-oxazole);tris(3,4,5-trimethyl-1,2-oxazole);bis(2,4,5-trimethyl-1,3-thiazole);3,4,5-trimethyl-1,2-thiazole |
|---|---|
| PubChem CID | 157050964 |
| Molecular Formula | C55H84N10O5S3 |
| Molecular Weight | 1061.54 g/mol |
| Exact Mass | 1060.58 |
| IUPAC Name | 1,3,4,5-tetramethylpyrazole;bis(2,4,5-trimethyl-1,3-oxazole);tris(3,4,5-trimethyl-1,2-oxazole);bis(2,4,5-trimethyl-1,3-thiazole);3,4,5-trimethyl-1,2-thiazole |
| SMILES | Cc1nc(C)c(C)o1.Cc1nc(C)c(C)o1.Cc1nc(C)c(C)s1.Cc1nc(C)c(C)s1.Cc1nn(C)c(C)c1C.Cc1noc(C)c1C.Cc1noc(C)c1C.Cc1noc(C)c1C.Cc1nsc(C)c1C |
| InChI | InChI=1S/C7H12N2.5C6H9NO.3C6H9NS/c1-5-6(2)8-9(4)7(5)3;2*1-4-5(2)8-6(3)7-4;3*1-4-5(2)7-8-6(4)3;2*1-4-5(2)8-6(3)7-4;1-4-5(2)7-8-6(4)3/h1-4H3;8*1-3H3 |
| InChIKey | AAEWKAYKFDDKDN-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 186.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.54 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |