C25H36O4 — CID 15705117
methyl 2-[(3R,5R)-3,5-dimethyl-5-[(5E,9E)-2-methyl-10-phenyldeca-5,9-dienyl]dioxolan-3-yl]acetate (PubChem CID 15705117) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is methyl 2-[(3R,5R)-3,5-dimethyl-5-[(5E,9E)-2-methyl-10-phenyldeca-5,9-dienyl]dioxolan-3-yl]acetate.
| Compound Name | methyl 2-[(3R,5R)-3,5-dimethyl-5-[(5E,9E)-2-methyl-10-phenyldeca-5,9-dienyl]dioxolan-3-yl]acetate |
|---|---|
| PubChem CID | 15705117 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | methyl 2-[(3R,5R)-3,5-dimethyl-5-[(5E,9E)-2-methyl-10-phenyldeca-5,9-dienyl]dioxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@@]1(C)C[C@@](C)(CC(C)CC/C=C/CC/C=C/c2ccccc2)OO1 |
| InChI | InChI=1S/C25H36O4/c1-21(18-24(2)20-25(3,29-28-24)19-23(26)27-4)14-10-7-5-6-8-11-15-22-16-12-9-13-17-22/h5,7,9,11-13,15-17,21H,6,8,10,14,18-20H2,1-4H3/b7-5+,15-11+/t21?,24-,25+/m1/s1 |
| InChIKey | GHRPFHNYOPGKTO-LEGLXJMISA-N |
| XLogP | 6.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|