C43H53N9O7 — CID 157051989
1,4-diethylpiperidine;N-(1-ethylpiperidin-4-yl)-N-methyl-4-(3-nitrophenyl)imidazole-1-carboxamide;phenyl 4-(3-nitrophenyl)imidazole-1-carboxylate (PubChem CID 157051989) has the molecular formula C43H53N9O7 and a molecular weight of 807.95 g/mol. Its IUPAC name is 1,4-diethylpiperidine;N-(1-ethylpiperidin-4-yl)-N-methyl-4-(3-nitrophenyl)imidazole-1-carboxamide;phenyl 4-(3-nitrophenyl)imidazole-1-carboxylate.
| Compound Name | 1,4-diethylpiperidine;N-(1-ethylpiperidin-4-yl)-N-methyl-4-(3-nitrophenyl)imidazole-1-carboxamide;phenyl 4-(3-nitrophenyl)imidazole-1-carboxylate |
|---|---|
| PubChem CID | 157051989 |
| Molecular Formula | C43H53N9O7 |
| Molecular Weight | 807.95 g/mol |
| Exact Mass | 807.41 |
| IUPAC Name | 1,4-diethylpiperidine;N-(1-ethylpiperidin-4-yl)-N-methyl-4-(3-nitrophenyl)imidazole-1-carboxamide;phenyl 4-(3-nitrophenyl)imidazole-1-carboxylate |
| SMILES | CCC1CCN(CC)CC1.CCN1CCC(N(C)C(=O)n2cnc(-c3cccc([N+](=O)[O-])c3)c2)CC1.O=C(Oc1ccccc1)n1cnc(-c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H23N5O3.C16H11N3O4.C9H19N/c1-3-21-9-7-15(8-10-21)20(2)18(24)22-12-17(19-13-22)14-5-4-6-16(11-14)23(25)26;20-16(23-14-7-2-1-3-8-14)18-10-15(17-11-18)12-5-4-6-13(9-12)19(21)22;1-3-9-5-7-10(4-2)8-6-9/h4-6,11-13,15H,3,7-10H2,1-2H3;1-11H;9H,3-8H2,1-2H3 |
| InChIKey | ZQHUZHKILVMMKU-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 175.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.95 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|