C13H22O6 — CID 15705276
[(2S,3R,4R,5S,6R)-4,5-dimethoxy-2-methyl-6-prop-2-enoxyoxan-3-yl] acetate (PubChem CID 15705276) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-4,5-dimethoxy-2-methyl-6-prop-2-enoxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6R)-4,5-dimethoxy-2-methyl-6-prop-2-enoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 15705276 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-4,5-dimethoxy-2-methyl-6-prop-2-enoxyoxan-3-yl] acetate |
| SMILES | C=CCO[C@@H]1O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C13H22O6/c1-6-7-17-13-12(16-5)11(15-4)10(8(2)18-13)19-9(3)14/h6,8,10-13H,1,7H2,2-5H3/t8-,10+,11+,12-,13+/m0/s1 |
| InChIKey | GLYGDYQSCGZTKB-ZYJFBCHUSA-N |
| XLogP | 0.90 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|