C29H27FN2O4 — CID 157053209
4-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]-3-(2-methoxyethoxy)benzoic acid (PubChem CID 157053209) has the molecular formula C29H27FN2O4 and a molecular weight of 486.54 g/mol. Its IUPAC name is 4-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]-3-(2-methoxyethoxy)benzoic acid.
| Compound Name | 4-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]-3-(2-methoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 157053209 |
| Molecular Formula | C29H27FN2O4 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]-3-(2-methoxyethoxy)benzoic acid |
| SMILES | COCCOc1cc(C(=O)O)ccc1-c1c(C(C)C)n(-c2ccc(F)cc2)c2cc3c(cc12)CN=C3 |
| InChI | InChI=1S/C29H27FN2O4/c1-17(2)28-27(23-9-4-18(29(33)34)14-26(23)36-11-10-35-3)24-12-19-15-31-16-20(19)13-25(24)32(28)22-7-5-21(30)6-8-22/h4-9,12-14,16-17H,10-11,15H2,1-3H3,(H,33,34) |
| InChIKey | NERQZOKCANCVNV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|